![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | LGBTQ Cultural Competence Training approved for Washington, DC (as per a public health priorities education for nurses).png | 2025-06-04 15:46 | 204K | |
| Older Adult and Geriatric Care for Texas Nurses.png | 2025-06-04 15:46 | 197K | |
| Elder Abuse and Dependent Adult Abuse Recognition and Reporting for Nurses and Other Healthcare Professionals.png | 2025-06-04 15:46 | 197K | |
| Dementia Alzheimer_s Disease Patient Care.png | 2025-06-04 15:46 | 191K | |
| Prescription Drug and Controlled Substance Abuse Opioid Diversion and Best-Practice Prescribing.png | 2025-06-04 15:46 | 189K | |
| Fall Prevention Interventions for Balance Problems and Risks.png | 2025-06-04 15:46 | 187K | |
| Child Abuse Mandated Reporter Training for New York State Identifying and Reporting Child Abuse and Maltreatment.png | 2025-06-04 15:46 | 186K | |
| Diabetes Care Prevention and Clinical Care of Diabetic Foot Ulcers.png | 2025-06-04 15:46 | 185K | |
| Incontinence Patient Care and Treatment.png | 2025-06-04 15:46 | 183K | |
| Child Abuse Recognition and Reporting in Pennsylvania - Act 31 (2 Hours) Mandated Reporter Training.png | 2025-06-04 15:46 | 181K | |
| Novel Coronaviruses including COVID-19 Mutations, Variants, and Vaccines.png | 2025-06-04 15:46 | 180K | |
| Cultural Competency and Implicit Bias Training Caring for LGBTQ+ Patients.png | 2025-06-04 15:46 | 180K | |
| Pressure Injury Prevention and Treatment Assessment, Wound Care, and Healing.png | 2025-06-04 15:46 | 179K | |
| Domestic Violence Education.png | 2025-06-04 15:46 | 176K | |
| Pain Management Assessment and Patient Care for Nurses and Other Healthcare Professionals.png | 2025-06-04 15:46 | 175K | |
| Suicide Intervention and Prevention.png | 2025-06-04 15:46 | 174K | |
| Understanding Mental Illness for All Healthcare Professionals Integrating Physical and Mental Health Care.png | 2025-06-04 15:46 | 173K | |
| COVID-19 The Impact of a Pandemic on Mental Health Providing Mental Health Interventions for Patients and Healthcare Workers.png | 2025-06-04 15:46 | 172K | |
| Diabetes in Children and Adolescents Symptoms and Management.png | 2025-06-04 15:46 | 172K | |
| Forensic Evidence Collection for Texas Nurses Sexual Assault Survivor Examination Guidelines.png | 2025-06-04 15:46 | 171K | |
| End-of-Life, Palliative, and Hospice Care.png | 2025-06-04 15:46 | 170K | |
| Florida Laws and Rules for Nursing.png | 2025-06-04 15:46 | 169K | |
| Stroke Comprehensive Acute Stroke Care.png | 2025-06-04 15:46 | 168K | |
| Elder Care.png | 2025-06-04 15:46 | 167K | |
| Posttraumatic Stress Disorder (PTSD) Symptoms and Treatment in Veterans.png | 2025-06-04 15:46 | 167K | |
| HIVAIDS Training and Education for Healthcare Professionals.png | 2025-06-04 15:46 | 166K | |
| Mental Health Crisis Intervention and Support for Patients.png | 2025-06-04 15:46 | 166K | |
| Obesity in America Management and Treatment in Children, Adolescents, and Adults.png | 2025-06-04 15:46 | 164K | |
| Sexual Harassment Training for Illinois Healthcare Professionals.png | 2025-06-04 15:46 | 164K | |
| Infection Control Preventing and Controlling Infectious Diseases, including COVID-19.png | 2025-06-04 15:46 | 163K | |
| Sexual Harassment Training.png | 2025-06-04 15:46 | 163K | |
| Telephone Triage Best Practice and Systems for Telehealth Nursing.png | 2025-06-04 15:46 | 162K | |
| Diabetes Type 1 Current Approaches in Patient Management for Individuals Diagnosed with Type 1 Diabetes.png | 2025-06-04 15:46 | 161K | |
| Healthcare Considerations for the Pregnant and Postpartum Patient Normal Changes, Complications, and Implications for Care.png | 2025-06-04 15:46 | 160K | |
| Nursing Jurisprudence and Ethics for Texas Standards of Nursing Practice.png | 2025-06-04 15:46 | 160K | |
| Suicide Prevention and Screening.png | 2025-06-04 15:46 | 159K | |
| Cardiac Patient Care Coronary Artery Disease (CAD).png | 2025-06-04 15:46 | 158K | |
| COVID-19 and Seasonal Flu 2022-2023 What Healthcare Professionals Need to Know.png | 2025-06-04 15:46 | 158K | |
| Substance Abuse Education for Delaware Nurses Drug Diversion Training and Best-Practice Prescribing.png | 2025-06-04 15:46 | 157K | |
| Workplace Violence and Safety Prevention and Solution Strategies.png | 2025-06-04 15:46 | 157K | |
| Best-Practice Prescribing and Drug Diversion Training for West Virginia Nurses (1 Hour).png | 2025-06-04 15:46 | 157K | |
| Pain Management for Oregon Nurses and Other Healthcare Professionals.png | 2025-06-04 15:46 | 157K | |
| Sexually Transmitted Infections (STIs) and Diseases (STDs) A Growing Epidemic.png | 2025-06-04 15:46 | 155K | |
| Clinical Care for the Heart Failure Patient.png | 2025-06-04 15:46 | 153K | |
| Chronic Obstructive Pulmonary Disease (COPD) Patient Management.png | 2025-06-04 15:46 | 153K | |
| Prevention of Medical Errors for Florida Healthcare Professionals.png | 2025-06-04 15:46 | 152K | |
| Pain and Pain Symptom Management for Michigan Nurses.png | 2025-06-04 15:46 | 152K | |
| Pediatric Abusive Head Trauma Child Abuse Prevention Shaken Baby Syndrome.png | 2025-06-04 15:46 | 151K | |
| Posttraumatic Stress Disorder (PTSD) for West Virginia Nurses Mental Health Conditions Common to Veterans.png | 2025-06-04 15:46 | 150K | |
| Human Trafficking Training for Florida Nurses and Other Healthcare Professionals Identifying Victims of Human Trafficking.png | 2025-06-04 15:46 | 149K | |
| Human Trafficking Victim Recognition and Intervention for Healthcare Professionals.png | 2025-06-04 15:46 | 149K | |
| Recognizing Impairment in the Workplace for Florida Nurses.png | 2025-06-04 15:46 | 149K | |
| Prostate Cancer Current Approaches in Nursing Care and Patient Management.png | 2025-06-04 15:46 | 148K | |
| Health and Behavior Techniques to Facilitate Change in Patients.png | 2025-06-04 15:46 | 148K | |
| Asthma Patient Care.png | 2025-06-04 15:46 | 148K | |
| Domestic Violence Education for Florida Nurses.png | 2025-06-04 15:46 | 148K | |
| Identifying and Reporting Child Abuse, Neglect, and Trafficking.png | 2025-06-04 15:46 | 146K | |
| Child Abuse Recognition and Reporting in Pennsylvania - Act 31 (3 Hours) Mandated Reporter Training.png | 2025-06-04 15:46 | 146K | |
| Cultural Competency, including Caring for LGBTQ+ Patients.png | 2025-06-04 15:46 | 146K | |
| Domestic Violence Education for Kentucky Nurses.png | 2025-06-04 15:46 | 146K | |
| Florida Occupational Therapy Laws and Rules.png | 2025-06-04 15:46 | 145K | |
| Bioterrorism and Weapons of Mass Destruction Emergency Preparedness for Nevada Nurses.png | 2025-06-04 15:46 | 143K | |
| Infection Control Training for New York State Healthcare Professionals.png | 2025-06-04 15:46 | 142K | |
| Metabolic Syndrome Risk, Diagnosis, and Treatment.png | 2025-06-04 15:46 | 142K | |
| Recognizing Impairment in the Workplace.png | 2025-06-04 15:46 | 139K | |
| Best-Practice Prescribing and Drug Diversion Training for West Virginia Nurses (3 Hours).png | 2025-06-04 15:46 | 139K | |
| Non-Cancer Pain Management for New Mexico Advanced Practice Nurses.png | 2025-06-04 15:46 | 138K | |
| Work-Related Stress Preventing Burnout, Compassion Fatigue, and Vicarious Trauma.png | 2025-06-04 15:46 | 138K | |
| Ethics and Law in Occupational Therapy Practice.png | 2025-06-04 15:46 | 136K | |
| HIVAIDS for Florida Healthcare Professionals.png | 2025-06-04 15:46 | 135K | |
| HIVAIDS Training for Washington Healthcare Professionals (7 Hours).png | 2025-06-04 15:46 | 132K | |
| Pediatric Abusive Head Trauma CE for Kentucky Nurses Prevent and Report Shaken Baby Syndrome.png | 2025-06-04 15:46 | 131K | |
| Breast Cancer Types, Treatment, and Survivorship Care.png | 2025-06-04 15:46 | 130K | |
| Diabetes Type 2 Prevention, Symptoms, and Treatment.png | 2025-06-04 15:46 | 130K | |
| Suicide Prevention Training Program for Washington Healthcare Professionals (6 Hours) Suicide Assessment, Treatment, and Management.png | 2025-06-04 15:46 | 128K | |
| Wound Care.png | 2025-06-04 15:46 | 126K | |
| Medical Errors Prevention and Patient Safety.png | 2025-06-04 15:46 | 126K | |
| Human Trafficking Prevention Training for Texas Healthcare Practitioners.png | 2025-06-04 15:46 | 120K | |
| Bloodborne Pathogens Training OSHA_s Bloodborne Pathogens Standard.png | 2025-06-04 15:46 | 119K | |
| Ethics, Laws, and Regulations for California Physical Therapy.png | 2025-06-04 15:46 | 117K | |
| Lung Cancer.png | 2025-06-04 15:46 | 112K | |
| Ohio Nurse Practice Act (2 Hours) Law and Rules - Category A.png | 2025-06-04 15:46 | 108K | |
| xcma-header-alzheimers-disease-continuing-education-ceu.jpg.pagespeed.ic.hauUaARZak.webp | 2025-06-04 15:46 | 65K | |
| xcma-header-elder-care-ceu.jpg.pagespeed.ic.D20GgSgKv5.jpg | 2025-06-04 15:46 | 39K | |
| 1 (4).jpg | 2025-06-04 15:46 | 30K | |
| xcma-header-copd-training-ceu.jpg.pagespeed.ic.KLe3VI8bK3.jpg | 2025-06-04 15:46 | 19K | |
| partnership-wime-wime.png | 2025-06-04 15:46 | 12K | |
| xwild-iris-medical-education-inc.png.pagespeed.ic.nrH8weaak-.webp | 2025-06-04 15:46 | 10K | |
| xcma-header-incontinence.jpg.pagespeed.ic.-KLBdJrvHb.webp | 2025-06-04 15:46 | 9.5K | |
| xcma-icon-alzheimers-disease-continuing-education-ceu.jpg.pagespeed.ic._KiycDT4RQ.webp | 2025-06-04 15:46 | 4.6K | |
| xcma-icon-elder-care-ceu.jpg.pagespeed.ic.RjQrjoxAU2.webp | 2025-06-04 15:46 | 4.6K | |
| xwild-iris-medical-education.png.pagespeed.ic.C36N1TqDY3.webp | 2025-06-04 15:46 | 4.2K | |
| xcma-icon-pressure-ulcer-assessment-treatment-ceu.jpg.pagespeed.ic.2Evi_hI_P7.webp | 2025-06-04 15:46 | 3.2K | |
| xcma-icon-asthma-ceu-continuing-education.jpg.pagespeed.ic.h4zSVZ5zMn.webp | 2025-06-04 15:46 | 3.1K | |
| xcma-icon-wound-care-ceu.jpg.pagespeed.ic.hkdAl5RRZP.webp | 2025-06-04 15:46 | 2.9K | |
![[ ]](/icons/unknown.gif) | download.webp | 2025-06-04 15:46 | 2.6K | |
| download (1).webp | 2025-06-04 15:46 | 2.6K | |
| xcma-icon-copd-training-ceu.jpg.pagespeed.ic.ggivjsH_DN.webp | 2025-06-04 15:46 | 2.5K | |
| xcma-icon-sexual-harassment-training-ceu.jpg.pagespeed.ic.xL4XsQN87u.webp | 2025-06-04 15:46 | 1.8K | |
![[DIR]](/icons/folder.gif) | humor-in-the-workplace-nha-updated-scorm12/ | 2025-06-04 15:46 | - | |
| humor-in-the-workplace-nha-updated-scorm12 (1)/ | 2025-06-04 15:46 | - | |
| WIME-course-775-Ethics-and-Law-in-Occupational-Therapy-Practice_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-774-Ethics-Laws-and-Regulations-for-California-Physical-Therapy_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-773-Child-Abuse-Mandated-Reporter-Training-for-New-York-State_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-771-Cultural-Competency-Training_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-769-Older-Adult-and-Geriatric-Care-for-Texas-Nurses_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-767-Human-Trafficking-Training-for-Michigan-Healthcare-Professionals_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-766-Human-Trafficking-Training-for-Florida-Nurses_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-765-Human-Trafficking_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-764-Metabolic-Syndrome_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-763-Dementia--Alzheimers-Disease-Diagnosis-Treatment-and-Care_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-762-Respiratory-Viruses--2023-2024-Vaccine-Update_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-761-Infection-Control_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-760-Human-Trafficking-Prevention-Training-for-Texas-Healthcare-Practioners_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-758-Bloodborne-Pathogens-Training_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-757-Diabetes-Type-2_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-756-Forensic-Evidence-Collection-for-Texas-Nurses_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-755-Infection-Control-Training-for-New-York-State-Healthcare-Professionals_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-754-Mental-Health-Crisis-Intervention-and-Support-for-Patients_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-753-Domestic-Violence-Education_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-752-Domestic-Violence-Education-for-Florida-Nurses_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-751-Posttraumatic-Stress-Disorder-(PTSD)_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-750-Domestic-Violence-Education-for-Kentucky-Nurses_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-749-Nursing-Jurisprudence-and-Ethics-for-Texas_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-748-Florida-Laws-and-Rules-for-Nursing_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-747-Suicide-Risk-and-Prevention-for-Kentucky-Nurses_with_EVAL (1)/ | 2025-06-04 15:46 | - | |
| WIME-course-745-Suicide-Prevention-and-Screening_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-744-Suicide-Intervention-and-Prevention_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-742-A-Look-at-Suicide--Prevention-Training-Program-for-Washington-Healthcare-Professionals-(3-Hours)_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-741-HIV-AIDS-Training-and-Education-for-Healthcare-Professionals_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-740-HIV-AIDS-for-Florida-Healthcare-Professionals/ | 2025-06-04 15:46 | - | |
| WIME-course-738-HIV-AIDS-Training-for-Washington-Healthcare-Professionals-(7-Hours)/ | 2025-06-04 15:46 | - | |
| WIME-course-736-Workplace-Violence-and-Safety_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-735-COVID-19--The-Impact-of-a-Pandemic-on-Mental-Health_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-734-Recognizing-Impairment-in-the-Workplace_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-733-Telephone-Triage_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-732-Assessment-Treatment-and-Management--Suicide-Prevention-Training-Program-for-Washington-Healthcare-Professionals-(6-Hours)-_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-731-Sexual-Harassment-Training_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-730-Pressure-Injuries_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-729-Cultural-Competency-including-Caring-for-LGBTQ+-Patients_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-727-Fall-Prevention_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-726-Implicit-Bias-Training-for-Nurses-and-Other-Healthcare-Professionals_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-725-Pain-Management-for-Oregon-Nurses-and-Other-Healthcare-Professionals_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-724-Non-Cancer-Pain-Management-for-New-Mexico-Advanced-Practice-Nurses_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-723-Recognizing-Impairment-in-the-Workplace-for-Florida-Nurses_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-722-Sexual-Harassment-Training-for-Illinois-Healthcare-Professionals_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-721-LGBTQ-Cultural-Competence-Training-approved-for-Washington-DC-(as-per-a-public-health-priorities-education-for-nurses)_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-720-Understanding-Mental-Illness-for-All-Healthcare-Professionals_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-719-End-of-Life-Palliative-and-Hospice-Care_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-718-COVID-19-and-Seasonal-Flu-2022-2023_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-717-Healthcare-Considerations-for-the-Pregnant-and-Postpartum-Patient_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-715-Health-and-Behavior_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-714-Stroke_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-713-Diabetes-Type-1_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-712-Breast-Cancer_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-711-Pain-Management_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-710-Wound-Care_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-709-Obesity-in-America_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-707-Chronic-Obstructive-Pulmonary-Disease-(COPD)_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-706-Pediatric-Abusive-Head-Trauma_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-705-Pediatric-Abusive-Head-Trauma-CE-for-Kentucky-Nurses_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-704-Dementia--Alzheimers-Disease-Patient-Care_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-703-Bioterrorism-and-Weapons-of-Mass-Destruction_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-702-Diabetes-Care--Prevention-and-Clinical-Care-of-Diabetic-Foot-Ulcers_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-701-Sexually-Transmitted-Infections-(STIs)-and-Diseases-(STDs)--A-Growing-Epidemic_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-699-Work-Related-Stress_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-698-Cardiac-Patient-Care--Coronary-Artery-Disease-(CAD)_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-694-Florida-Occupational-Therapy-Laws-and-Rules_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-693-Asthma-Patient-Care_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-693-Asthma-Patient-Care/ | 2025-06-04 15:46 | - | |
| WIME-course-692-Novel-Coronaviruses-including-COVID-19_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-691-Ohio-Nurse-Practice-Act-(2-Hours)_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-689-Prostate-Cancer_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-688-Identifying-and-Reporting-Child-Abuse-Neglect-and-Trafficking_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-687-Child-Abuse-Mandated-Reporter-Training-for-New-York-State_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-686-Substance-Abuse-Education-for-Delaware-Nurses_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-685-Pain-and-Pain-Symptom-Management-for-Michigan-Nurses_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-684-Prescription-Drug-and-Controlled-Substance-Abuse_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-683-Best-Practice-Prescribing-and-Drug-Diversion-Training-for-West-Virginia-Nurses-(1-Hour)_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-682-Best-Practice-Prescribing-and-Drug-Diversion-Training-for-West-Virginia-Nurses-(3-Hours)_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-679-Prevention-of-Medical-Errors-for-Florida-Healthcare-Professionals_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-678-Medical-Errors_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-677-Ethics-and-Law-in-Occupational-Therapy-Practice_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-676-Ethics-Laws-and-Regulations-for-California-Physical-Therapy_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-675-Clinical-Care-for-the-Heart-Failure-Patient_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-674-Elder-Abuse-and-Dependent-Adult-Abuse_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-673-Human-Trafficking_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-672-Human-Trafficking-Training-for-Michigan-Healthcare-Professionals_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-671-Human-Trafficking-Training-for-Florida-Nurses-and-Other-Healthcare-Professionals_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-670-Metabolic-Syndrome_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-669-Bloodborne-Pathogens-Training_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-668-Older-Adult-and-Geriatric-Care-for-Texas-Nurses_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-667-Elder-Care_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-665-Posttraumatic-Stress-Disorder-(PTSD)_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-664-Posttraumatic-Stress-Disorder-(PTSD)-for-West-Virginia-Nurses_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-663-Nursing-Jurisprudence-and-Ethics-for-Texas_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-662-Forensic-Evidence-Collection-for-Texas-Nurses_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-661-Infection-Control-Training-for-New-York-State-Healthcare-Professionals_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-660-Infection-Control_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-659-Diabetes-in-Children-and-Adolescents_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-658-Human-Trafficking-Prevention-Training-for-Texas-Healthcare-Practitioners_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-656-Diabetes-Type-2_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-655-Florida-Laws-and-Rules-for-Nursing_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-654-Mental-Health-Crisis-Intervention-and-Support-for-Patients_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-651-Domestic-Violence-Education-for-Florida-Nurses_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-650-Domestic-Violence-Education-for-Kentucky-Nurses_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-649-Domestic-Violence-Education_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-647-Suicide-Prevention-Training-Program-for-Washington-Healthcare-Professionals-(3-Hours)_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-643-Telephone-Triage_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-641-HIV-AIDS-for-Florida-Healthcare-Professionals_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-640-HIV-AIDS-Training-for-Washington-Healthcare-Professionals-(4-Hours)_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-639-HIV-AIDS-Training-and-Education-for-Healthcare-Professionals_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-631-Incontinence_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-628-Suicide-Prevention-Training-Program-for-Washington-Healthcare-Professionals-(6-Hours)_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-627-Pressure-Injury-Prevention-and-Treatment_with_EVAL/ | 2025-06-04 15:46 | - | |
| WIME-course-620-Lung-Cancer_with_EVAL/ | 2025-06-04 15:46 | - | |
| Scorm Files/ | 2025-06-04 15:46 | - | |
|
|---|
.png){kind=link}
%20Mandated%20Reporter%20Training.png){kind=link}
%20Symptoms%20and%20Treatment%20in%20Veterans.png){kind=link}
.png){kind=link}
.png){kind=link}
%20and%20Diseases%20(STDs)%20A%20Growing%20Epidemic.png){kind=link}
%20Patient%20Management.png){kind=link}
%20for%20West%20Virginia%20Nurses%20Mental%20Health%20Conditions%20Common%20to%20Veterans.png){kind=link}
%20Mandated%20Reporter%20Training.png){kind=link}
.png){kind=link}
.png){kind=link}
%20Suicide%20Assessment,%20Treatment,%20and%20Management.png){kind=link}
%20Law%20and%20Rules%20-%20Category%20A.png){kind=link}
.jpg){kind=link}
.webp){kind=link}
